C14H15NO2 — CID 65152808
2-pyridin-2-yl-1-(2,4,5-trimethylfuran-3-yl)ethanone (PubChem CID 65152808) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-pyridin-2-yl-1-(2,4,5-trimethylfuran-3-yl)ethanone.
| Compound Name | 2-pyridin-2-yl-1-(2,4,5-trimethylfuran-3-yl)ethanone |
|---|---|
| PubChem CID | 65152808 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-pyridin-2-yl-1-(2,4,5-trimethylfuran-3-yl)ethanone |
| SMILES | Cc1oc(C)c(C(=O)Cc2ccccn2)c1C |
| InChI | InChI=1S/C14H15NO2/c1-9-10(2)17-11(3)14(9)13(16)8-12-6-4-5-7-15-12/h4-7H,8H2,1-3H3 |
| InChIKey | KQYNZBDRYJYUJZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |