C15H18N2O3 — CID 65153343
2-(2-nitrophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanamine (PubChem CID 65153343) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanamine.
| Compound Name | 2-(2-nitrophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanamine |
|---|---|
| PubChem CID | 65153343 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-(2-nitrophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanamine |
| SMILES | Cc1oc(C)c(C(N)Cc2ccccc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C15H18N2O3/c1-9-10(2)20-11(3)15(9)13(16)8-12-6-4-5-7-14(12)17(18)19/h4-7,13H,8,16H2,1-3H3 |
| InChIKey | YKDDPLCRSZWLHR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|