C11H15BrOS — CID 65153708
1-(4-bromothiophen-2-yl)-2-cyclopropylbutan-2-ol (PubChem CID 65153708) has the molecular formula C11H15BrOS and a molecular weight of 275.21 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-2-cyclopropylbutan-2-ol.
| Compound Name | 1-(4-bromothiophen-2-yl)-2-cyclopropylbutan-2-ol |
|---|---|
| PubChem CID | 65153708 |
| Molecular Formula | C11H15BrOS |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-2-cyclopropylbutan-2-ol |
| SMILES | CCC(O)(Cc1cc(Br)cs1)C1CC1 |
| InChI | InChI=1S/C11H15BrOS/c1-2-11(13,8-3-4-8)6-10-5-9(12)7-14-10/h5,7-8,13H,2-4,6H2,1H3 |
| InChIKey | CTAIJWJBOFGXBE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |