C23H19N3OS — CID 6515961
methyl N'-[(Z)-(2-oxo-3,3-diphenylinden-1-ylidene)amino]carbamimidothioate (PubChem CID 6515961) has the molecular formula C23H19N3OS and a molecular weight of 385.49 g/mol. Its IUPAC name is methyl N'-[(Z)-(2-oxo-3,3-diphenylinden-1-ylidene)amino]carbamimidothioate.
| Compound Name | methyl N'-[(Z)-(2-oxo-3,3-diphenylinden-1-ylidene)amino]carbamimidothioate |
|---|---|
| PubChem CID | 6515961 |
| Molecular Formula | C23H19N3OS |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | methyl N'-[(Z)-(2-oxo-3,3-diphenylinden-1-ylidene)amino]carbamimidothioate |
| SMILES | CS/C(N)=N/N=C1\C(=O)C(c2ccccc2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H19N3OS/c1-28-22(24)26-25-20-18-14-8-9-15-19(18)23(21(20)27,16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-15H,1H3,(H2,24,26)/b25-20- |
| InChIKey | BWVQVUIZEBIEGF-QQTULTPQSA-N |
| XLogP | 3.99 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|