C20H21ClN2O4 — CID 6516110
(E)-3-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 6516110) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6516110 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | C#CCOc1c(Cl)cc(/C=C(\C#N)C(=O)NCC2CCCO2)cc1OCC |
| InChI | InChI=1S/C20H21ClN2O4/c1-3-7-27-19-17(21)10-14(11-18(19)25-4-2)9-15(12-22)20(24)23-13-16-6-5-8-26-16/h1,9-11,16H,4-8,13H2,2H3,(H,23,24)/b15-9+ |
| InChIKey | WCWAFWRVBNQPQM-OQLLNIDSSA-N |
| XLogP | 2.95 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|