C13H16Br3NO — CID 65163342
2,4,6-tribromo-N-[3-(oxolan-2-yl)propyl]aniline (PubChem CID 65163342) has the molecular formula C13H16Br3NO and a molecular weight of 441.99 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[3-(oxolan-2-yl)propyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[3-(oxolan-2-yl)propyl]aniline |
|---|---|
| PubChem CID | 65163342 |
| Molecular Formula | C13H16Br3NO |
| Molecular Weight | 441.99 g/mol |
| Exact Mass | 438.88 |
| IUPAC Name | 2,4,6-tribromo-N-[3-(oxolan-2-yl)propyl]aniline |
| SMILES | Brc1cc(Br)c(NCCCC2CCCO2)c(Br)c1 |
| InChI | InChI=1S/C13H16Br3NO/c14-9-7-11(15)13(12(16)8-9)17-5-1-3-10-4-2-6-18-10/h7-8,10,17H,1-6H2 |
| InChIKey | MEHUGUHMUOOMLA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.99 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|