C12H14Br3NO — CID 65163343
2,4,6-tribromo-N-[2-(oxolan-2-yl)ethyl]aniline (PubChem CID 65163343) has the molecular formula C12H14Br3NO and a molecular weight of 427.96 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[2-(oxolan-2-yl)ethyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[2-(oxolan-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 65163343 |
| Molecular Formula | C12H14Br3NO |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 424.86 |
| IUPAC Name | 2,4,6-tribromo-N-[2-(oxolan-2-yl)ethyl]aniline |
| SMILES | Brc1cc(Br)c(NCCC2CCCO2)c(Br)c1 |
| InChI | InChI=1S/C12H14Br3NO/c13-8-6-10(14)12(11(15)7-8)16-4-3-9-2-1-5-17-9/h6-7,9,16H,1-5H2 |
| InChIKey | LPTRTJWLDRILLZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |