C8H13N3O — CID 65165120
1-[2-(oxolan-2-yl)ethyl]-1,2,4-triazole (PubChem CID 65165120) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-[2-(oxolan-2-yl)ethyl]-1,2,4-triazole.
| Compound Name | 1-[2-(oxolan-2-yl)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 65165120 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-[2-(oxolan-2-yl)ethyl]-1,2,4-triazole |
| SMILES | c1ncn(CCC2CCCO2)n1 |
| InChI | InChI=1S/C8H13N3O/c1-2-8(12-5-1)3-4-11-7-9-6-10-11/h6-8H,1-5H2 |
| InChIKey | WVZDWMHJAJVJJV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |