About 2-(5-bromoheptyl)oxolane
2-(5-bromoheptyl)oxolane (PubChem CID 65166211) has the molecular formula C11H21BrO
and a molecular weight of 249.19 g/mol. Its IUPAC name is 2-(5-bromoheptyl)oxolane.
Molecular Properties
| Compound Name | 2-(5-bromoheptyl)oxolane |
| PubChem CID | 65166211 |
| Molecular Formula | C11H21BrO |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-(5-bromoheptyl)oxolane |
| SMILES | CCC(Br)CCCCC1CCCO1 |
| InChI | InChI=1S/C11H21BrO/c1-2-10(12)6-3-4-7-11-8-5-9-13-11/h10-11H,2-9H2,1H3 |
| InChIKey | SZWNZYDBQVCQSQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromoheptyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromoheptyl)oxolane?
The IUPAC name of 2-(5-bromoheptyl)oxolane (CID 65166211) is 2-(5-bromoheptyl)oxolane.
What is the SMILES notation for 2-(5-bromoheptyl)oxolane?
The canonical SMILES for 2-(5-bromoheptyl)oxolane is CCC(Br)CCCCC1CCCO1.
What is the InChIKey of 2-(5-bromoheptyl)oxolane?
The InChIKey is SZWNZYDBQVCQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21BrO/c1-2-10(12)6-3-4-7-11-8-5-9-13-11/h10-11H,2-9H2,1H3.
What are the key properties of 2-(5-bromoheptyl)oxolane?
2-(5-bromoheptyl)oxolane has a molecular weight of 249.19 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromoheptyl)oxolane is sourced from PubChem (CID 65166211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).