C14H28N2O — CID 65168019
N'-(3-ethoxyspiro[3.5]nonan-1-yl)propane-1,3-diamine (PubChem CID 65168019) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is N'-(3-ethoxyspiro[3.5]nonan-1-yl)propane-1,3-diamine.
| Compound Name | N'-(3-ethoxyspiro[3.5]nonan-1-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 65168019 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | N'-(3-ethoxyspiro[3.5]nonan-1-yl)propane-1,3-diamine |
| SMILES | CCOC1CC(NCCCN)C12CCCCC2 |
| InChI | InChI=1S/C14H28N2O/c1-2-17-13-11-12(16-10-6-9-15)14(13)7-4-3-5-8-14/h12-13,16H,2-11,15H2,1H3 |
| InChIKey | NEZTVAFQEUMWLY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|