About ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid
ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid (PubChem CID 651683) has the molecular formula C17H22N4O6
and a molecular weight of 378.39 g/mol. Its IUPAC name is ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid.
Molecular Properties
| Compound Name | ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid |
| PubChem CID | 651683 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid |
| SMILES | CCOC(=O)N1CCN(Cc2cn3ccccc3n2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H20N4O2.C2H2O4/c1-2-21-15(20)18-9-7-17(8-10-18)11-13-12-19-6-4-3-5-14(19)16-13;3-1(4)2(5)6/h3-6,12H,2,7-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | TVAJABJWUDMRAH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid?
The IUPAC name of ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid (CID 651683) is ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid.
What is the SMILES notation for ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid?
The canonical SMILES for ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid is CCOC(=O)N1CCN(Cc2cn3ccccc3n2)CC1.O=C(O)C(=O)O.
What is the InChIKey of ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid?
The InChIKey is TVAJABJWUDMRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O2.C2H2O4/c1-2-21-15(20)18-9-7-17(8-10-18)11-13-12-19-6-4-3-5-14(19)16-13;3-1(4)2(5)6/h3-6,12H,2,7-11H2,1H3;(H,3,4)(H,5,6).
What are the key properties of ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid?
ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid has a molecular weight of 378.39 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxylate;oxalic acid is sourced from PubChem (CID 651683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).