C13H24N2S — CID 65169094
3-(4,5-dimethyl-1,3-thiazol-2-yl)-N-propylpentan-2-amine (PubChem CID 65169094) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N-propylpentan-2-amine.
| Compound Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 65169094 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N-propylpentan-2-amine |
| SMILES | CCCNC(C)C(CC)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C13H24N2S/c1-6-8-14-10(4)12(7-2)13-15-9(3)11(5)16-13/h10,12,14H,6-8H2,1-5H3 |
| InChIKey | HJXYNKREIUWBEO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |