C10H17NO4S — CID 65171124
7-methyl-1,1-dioxo-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine-3-carboxylic acid (PubChem CID 65171124) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 7-methyl-1,1-dioxo-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine-3-carboxylic acid.
| Compound Name | 7-methyl-1,1-dioxo-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine-3-carboxylic acid |
|---|---|
| PubChem CID | 65171124 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 7-methyl-1,1-dioxo-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine-3-carboxylic acid |
| SMILES | CC1CCC2NC(C(=O)O)CS(=O)(=O)C2C1 |
| InChI | InChI=1S/C10H17NO4S/c1-6-2-3-7-9(4-6)16(14,15)5-8(11-7)10(12)13/h6-9,11H,2-5H2,1H3,(H,12,13) |
| InChIKey | RXOXRQTYGKBYAV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |