C16H20BrN3O — CID 65171964
N-[[3-[(3-bromo-4-methoxyphenyl)methyl]-2-methylimidazol-4-yl]methyl]cyclopropanamine (PubChem CID 65171964) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is N-[[3-[(3-bromo-4-methoxyphenyl)methyl]-2-methylimidazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[3-[(3-bromo-4-methoxyphenyl)methyl]-2-methylimidazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65171964 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-[[3-[(3-bromo-4-methoxyphenyl)methyl]-2-methylimidazol-4-yl]methyl]cyclopropanamine |
| SMILES | COc1ccc(Cn2c(CNC3CC3)cnc2C)cc1Br |
| InChI | InChI=1S/C16H20BrN3O/c1-11-18-8-14(9-19-13-4-5-13)20(11)10-12-3-6-16(21-2)15(17)7-12/h3,6-8,13,19H,4-5,9-10H2,1-2H3 |
| InChIKey | XIVQODQQAADNSC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |