C11H19N3O — CID 65172121
N-[[3-(2-methoxyethyl)-2-methylimidazol-4-yl]methyl]cyclopropanamine (PubChem CID 65172121) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[[3-(2-methoxyethyl)-2-methylimidazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(2-methoxyethyl)-2-methylimidazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65172121 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-[[3-(2-methoxyethyl)-2-methylimidazol-4-yl]methyl]cyclopropanamine |
| SMILES | COCCn1c(CNC2CC2)cnc1C |
| InChI | InChI=1S/C11H19N3O/c1-9-12-7-11(8-13-10-3-4-10)14(9)5-6-15-2/h7,10,13H,3-6,8H2,1-2H3 |
| InChIKey | AMHRTUYTLHXXHV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |