About 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine
3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine (PubChem CID 65174640) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine.
Molecular Properties
| Compound Name | 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine |
| PubChem CID | 65174640 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine |
| SMILES | Cc1ccc(CC2=CC(N)CC2)cc1C |
| InChI | InChI=1S/C14H19N/c1-10-3-4-12(7-11(10)2)8-13-5-6-14(15)9-13/h3-4,7,9,14H,5-6,8,15H2,1-2H3 |
| InChIKey | RIKGBFRLVPCQRZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine?
The IUPAC name of 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine (CID 65174640) is 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine.
What is the SMILES notation for 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine?
The canonical SMILES for 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine is Cc1ccc(CC2=CC(N)CC2)cc1C.
What is the InChIKey of 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine?
The InChIKey is RIKGBFRLVPCQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-10-3-4-12(7-11(10)2)8-13-5-6-14(15)9-13/h3-4,7,9,14H,5-6,8,15H2,1-2H3.
What are the key properties of 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine?
3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine has a molecular weight of 201.31 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethylphenyl)methyl]cyclopent-2-en-1-amine is sourced from PubChem (CID 65174640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).