C13H15N — CID 160547362
4-[(3,4-dimethylphenyl)methyl]-3H-pyrrole (PubChem CID 160547362) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)methyl]-3H-pyrrole.
| Compound Name | 4-[(3,4-dimethylphenyl)methyl]-3H-pyrrole |
|---|---|
| PubChem CID | 160547362 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)methyl]-3H-pyrrole |
| SMILES | Cc1ccc(CC2=CN=CC2)cc1C |
| InChI | InChI=1S/C13H15N/c1-10-3-4-12(7-11(10)2)8-13-5-6-14-9-13/h3-4,6-7,9H,5,8H2,1-2H3 |
| InChIKey | HOVYDPVGKCZIMZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |