C13H19NS — CID 134172754
2-[2-(3,4-dimethylphenyl)ethyl]-N-methylthiiran-2-amine (PubChem CID 134172754) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenyl)ethyl]-N-methylthiiran-2-amine.
| Compound Name | 2-[2-(3,4-dimethylphenyl)ethyl]-N-methylthiiran-2-amine |
|---|---|
| PubChem CID | 134172754 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-[2-(3,4-dimethylphenyl)ethyl]-N-methylthiiran-2-amine |
| SMILES | CNC1(CCc2ccc(C)c(C)c2)CS1 |
| InChI | InChI=1S/C13H19NS/c1-10-4-5-12(8-11(10)2)6-7-13(14-3)9-15-13/h4-5,8,14H,6-7,9H2,1-3H3 |
| InChIKey | UQBOYIHFJRPXMC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|