C12H20N2O — CID 65175697
4-N-(3-ethoxypropyl)-4-N-methylbenzene-1,4-diamine (PubChem CID 65175697) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-N-(3-ethoxypropyl)-4-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-(3-ethoxypropyl)-4-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 65175697 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-N-(3-ethoxypropyl)-4-N-methylbenzene-1,4-diamine |
| SMILES | CCOCCCN(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H20N2O/c1-3-15-10-4-9-14(2)12-7-5-11(13)6-8-12/h5-8H,3-4,9-10,13H2,1-2H3 |
| InChIKey | YKNXNBSFMCCBMD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|