C12H12Cl2N2O — CID 65179221
N-[[5-(2,3-dichlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine (PubChem CID 65179221) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is N-[[5-(2,3-dichlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(2,3-dichlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 65179221 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | N-[[5-(2,3-dichlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1ncc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C12H12Cl2N2O/c1-2-15-7-11-16-6-10(17-11)8-4-3-5-9(13)12(8)14/h3-6,15H,2,7H2,1H3 |
| InChIKey | YBHKNNOQOJUNIH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |