C12H11ClF2N2O — CID 82773672
N-[[5-(4-chloro-2,5-difluorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine (PubChem CID 82773672) has the molecular formula C12H11ClF2N2O and a molecular weight of 272.68 g/mol. Its IUPAC name is N-[[5-(4-chloro-2,5-difluorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(4-chloro-2,5-difluorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 82773672 |
| Molecular Formula | C12H11ClF2N2O |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-[[5-(4-chloro-2,5-difluorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1ncc(-c2cc(F)c(Cl)cc2F)o1 |
| InChI | InChI=1S/C12H11ClF2N2O/c1-2-16-6-12-17-5-11(18-12)7-3-10(15)8(13)4-9(7)14/h3-5,16H,2,6H2,1H3 |
| InChIKey | HYQYOOZGSLRLJY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|