C11H11N3O3 — CID 65179785
[5-(2-methyl-3-nitrophenyl)-1,3-oxazol-2-yl]methanamine (PubChem CID 65179785) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is [5-(2-methyl-3-nitrophenyl)-1,3-oxazol-2-yl]methanamine.
| Compound Name | [5-(2-methyl-3-nitrophenyl)-1,3-oxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 65179785 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | [5-(2-methyl-3-nitrophenyl)-1,3-oxazol-2-yl]methanamine |
| SMILES | Cc1c(-c2cnc(CN)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N3O3/c1-7-8(3-2-4-9(7)14(15)16)10-6-13-11(5-12)17-10/h2-4,6H,5,12H2,1H3 |
| InChIKey | DPIMTGZQCVGVKU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|