About [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine
[5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine (PubChem CID 65178572) has the molecular formula C10H9IN2O
and a molecular weight of 300.10 g/mol. Its IUPAC name is [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine |
| PubChem CID | 65178572 |
| Molecular Formula | C10H9IN2O |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine |
| SMILES | NCc1ncc(-c2ccccc2I)o1 |
| InChI | InChI=1S/C10H9IN2O/c11-8-4-2-1-3-7(8)9-6-13-10(5-12)14-9/h1-4,6H,5,12H2 |
| InChIKey | QZPFIRXGELZYGO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine?
The IUPAC name of [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine (CID 65178572) is [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine.
What is the SMILES notation for [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine?
The canonical SMILES for [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine is NCc1ncc(-c2ccccc2I)o1.
What is the InChIKey of [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine?
The InChIKey is QZPFIRXGELZYGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2O/c11-8-4-2-1-3-7(8)9-6-13-10(5-12)14-9/h1-4,6H,5,12H2.
What are the key properties of [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine?
[5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine has a molecular weight of 300.10 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine is sourced from PubChem (CID 65178572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).