C10H9IN2O — CID 65178572
[5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine (PubChem CID 65178572) has the molecular formula C10H9IN2O and a molecular weight of 300.10 g/mol. Its IUPAC name is [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine.
| Compound Name | [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 65178572 |
| Molecular Formula | C10H9IN2O |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | [5-(2-iodophenyl)-1,3-oxazol-2-yl]methanamine |
| SMILES | NCc1ncc(-c2ccccc2I)o1 |
| InChI | InChI=1S/C10H9IN2O/c11-8-4-2-1-3-7(8)9-6-13-10(5-12)14-9/h1-4,6H,5,12H2 |
| InChIKey | QZPFIRXGELZYGO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|