C12H22N2O2 — CID 65182423
2-(5-butyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)ethanamine (PubChem CID 65182423) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-(5-butyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)ethanamine.
| Compound Name | 2-(5-butyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 65182423 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-(5-butyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)ethanamine |
| SMILES | CCCCc1cnc(CCNCCOC)o1 |
| InChI | InChI=1S/C12H22N2O2/c1-3-4-5-11-10-14-12(16-11)6-7-13-8-9-15-2/h10,13H,3-9H2,1-2H3 |
| InChIKey | UEYANSGOUSBDGK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|