C12H19F3N2O3 — CID 103213216
N-(2-methoxyethyl)-2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-oxazol-2-yl]ethanamine (PubChem CID 103213216) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-oxazol-2-yl]ethanamine.
| Compound Name | N-(2-methoxyethyl)-2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 103213216 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(2-methoxyethyl)-2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-oxazol-2-yl]ethanamine |
| SMILES | COCCNCCc1ncc(CCOCC(F)(F)F)o1 |
| InChI | InChI=1S/C12H19F3N2O3/c1-18-7-5-16-4-2-11-17-8-10(20-11)3-6-19-9-12(13,14)15/h8,16H,2-7,9H2,1H3 |
| InChIKey | JWJYMJMXDASYPD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|