C14H23F3N2O2 — CID 103213242
2-methyl-N-[3-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-oxazol-2-yl]propyl]propan-1-amine (PubChem CID 103213242) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-methyl-N-[3-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-oxazol-2-yl]propyl]propan-1-amine.
| Compound Name | 2-methyl-N-[3-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-oxazol-2-yl]propyl]propan-1-amine |
|---|---|
| PubChem CID | 103213242 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-methyl-N-[3-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-oxazol-2-yl]propyl]propan-1-amine |
| SMILES | CC(C)CNCCCc1ncc(CCOCC(F)(F)F)o1 |
| InChI | InChI=1S/C14H23F3N2O2/c1-11(2)8-18-6-3-4-13-19-9-12(21-13)5-7-20-10-14(15,16)17/h9,11,18H,3-8,10H2,1-2H3 |
| InChIKey | OTOAASOXZCSVKK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|