C12H20N2O2 — CID 65183995
N-[[5-(oxan-3-yl)-1,3-oxazol-2-yl]methyl]propan-1-amine (PubChem CID 65183995) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-[[5-(oxan-3-yl)-1,3-oxazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(oxan-3-yl)-1,3-oxazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65183995 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-[[5-(oxan-3-yl)-1,3-oxazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ncc(C2CCCOC2)o1 |
| InChI | InChI=1S/C12H20N2O2/c1-2-5-13-8-12-14-7-11(16-12)10-4-3-6-15-9-10/h7,10,13H,2-6,8-9H2,1H3 |
| InChIKey | RXVIATZMRYHSCG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|