C14H18N2O — CID 65184233
N-[[5-(2-methylphenyl)-1,3-oxazol-2-yl]methyl]propan-1-amine (PubChem CID 65184233) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[[5-(2-methylphenyl)-1,3-oxazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2-methylphenyl)-1,3-oxazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65184233 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-[[5-(2-methylphenyl)-1,3-oxazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ncc(-c2ccccc2C)o1 |
| InChI | InChI=1S/C14H18N2O/c1-3-8-15-10-14-16-9-13(17-14)12-7-5-4-6-11(12)2/h4-7,9,15H,3,8,10H2,1-2H3 |
| InChIKey | XZEKNPCWSWWQGM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|