C12H16N2OS — CID 79807638
N-[[5-(4-methylthiophen-3-yl)-1,3-oxazol-2-yl]methyl]propan-1-amine (PubChem CID 79807638) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-[[5-(4-methylthiophen-3-yl)-1,3-oxazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(4-methylthiophen-3-yl)-1,3-oxazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 79807638 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-[[5-(4-methylthiophen-3-yl)-1,3-oxazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ncc(-c2cscc2C)o1 |
| InChI | InChI=1S/C12H16N2OS/c1-3-4-13-6-12-14-5-11(15-12)10-8-16-7-9(10)2/h5,7-8,13H,3-4,6H2,1-2H3 |
| InChIKey | XOLSKJQCAREWID-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|