C12H22N2O — CID 65184333
N-[[5-(3-methylbutyl)-1,3-oxazol-2-yl]methyl]propan-1-amine (PubChem CID 65184333) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[[5-(3-methylbutyl)-1,3-oxazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(3-methylbutyl)-1,3-oxazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65184333 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[[5-(3-methylbutyl)-1,3-oxazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ncc(CCC(C)C)o1 |
| InChI | InChI=1S/C12H22N2O/c1-4-7-13-9-12-14-8-11(15-12)6-5-10(2)3/h8,10,13H,4-7,9H2,1-3H3 |
| InChIKey | MQZXHPISCFAYSM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|