C18H22ClNO — CID 65184766
1-amino-2-(2-chlorophenyl)-6-phenylhexan-3-ol (PubChem CID 65184766) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is 1-amino-2-(2-chlorophenyl)-6-phenylhexan-3-ol.
| Compound Name | 1-amino-2-(2-chlorophenyl)-6-phenylhexan-3-ol |
|---|---|
| PubChem CID | 65184766 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-amino-2-(2-chlorophenyl)-6-phenylhexan-3-ol |
| SMILES | NCC(c1ccccc1Cl)C(O)CCCc1ccccc1 |
| InChI | InChI=1S/C18H22ClNO/c19-17-11-5-4-10-15(17)16(13-20)18(21)12-6-9-14-7-2-1-3-8-14/h1-5,7-8,10-11,16,18,21H,6,9,12-13,20H2 |
| InChIKey | BNVYMADGVYEACC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |