C17H19F2NO — CID 65189724
1-amino-2-(2,4-difluorophenyl)-5-phenylpentan-3-ol (PubChem CID 65189724) has the molecular formula C17H19F2NO and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-amino-2-(2,4-difluorophenyl)-5-phenylpentan-3-ol.
| Compound Name | 1-amino-2-(2,4-difluorophenyl)-5-phenylpentan-3-ol |
|---|---|
| PubChem CID | 65189724 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-amino-2-(2,4-difluorophenyl)-5-phenylpentan-3-ol |
| SMILES | NCC(c1ccc(F)cc1F)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C17H19F2NO/c18-13-7-8-14(16(19)10-13)15(11-20)17(21)9-6-12-4-2-1-3-5-12/h1-5,7-8,10,15,17,21H,6,9,11,20H2 |
| InChIKey | ZECGOSXZYLQQPQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |