C15H17ClFNO2 — CID 65189777
1-amino-2-(2-chloro-4-fluorophenyl)-5-(furan-2-yl)pentan-3-ol (PubChem CID 65189777) has the molecular formula C15H17ClFNO2 and a molecular weight of 297.76 g/mol. Its IUPAC name is 1-amino-2-(2-chloro-4-fluorophenyl)-5-(furan-2-yl)pentan-3-ol.
| Compound Name | 1-amino-2-(2-chloro-4-fluorophenyl)-5-(furan-2-yl)pentan-3-ol |
|---|---|
| PubChem CID | 65189777 |
| Molecular Formula | C15H17ClFNO2 |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-amino-2-(2-chloro-4-fluorophenyl)-5-(furan-2-yl)pentan-3-ol |
| SMILES | NCC(c1ccc(F)cc1Cl)C(O)CCc1ccco1 |
| InChI | InChI=1S/C15H17ClFNO2/c16-14-8-10(17)3-5-12(14)13(9-18)15(19)6-4-11-2-1-7-20-11/h1-3,5,7-8,13,15,19H,4,6,9,18H2 |
| InChIKey | MCXSIXFHVQAANZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |