C16H20FNOS — CID 65185921
1-amino-2-(2-fluorophenyl)-6-thiophen-2-ylhexan-3-ol (PubChem CID 65185921) has the molecular formula C16H20FNOS and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-amino-2-(2-fluorophenyl)-6-thiophen-2-ylhexan-3-ol.
| Compound Name | 1-amino-2-(2-fluorophenyl)-6-thiophen-2-ylhexan-3-ol |
|---|---|
| PubChem CID | 65185921 |
| Molecular Formula | C16H20FNOS |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-amino-2-(2-fluorophenyl)-6-thiophen-2-ylhexan-3-ol |
| SMILES | NCC(c1ccccc1F)C(O)CCCc1cccs1 |
| InChI | InChI=1S/C16H20FNOS/c17-15-8-2-1-7-13(15)14(11-18)16(19)9-3-5-12-6-4-10-20-12/h1-2,4,6-8,10,14,16,19H,3,5,9,11,18H2 |
| InChIKey | IHNZEYSXDBROAZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |