C16H18FNO — CID 65186538
3-amino-1-(5-fluoro-2-methylphenyl)-2-phenylpropan-1-ol (PubChem CID 65186538) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is 3-amino-1-(5-fluoro-2-methylphenyl)-2-phenylpropan-1-ol.
| Compound Name | 3-amino-1-(5-fluoro-2-methylphenyl)-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 65186538 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-amino-1-(5-fluoro-2-methylphenyl)-2-phenylpropan-1-ol |
| SMILES | Cc1ccc(F)cc1C(O)C(CN)c1ccccc1 |
| InChI | InChI=1S/C16H18FNO/c1-11-7-8-13(17)9-14(11)16(19)15(10-18)12-5-3-2-4-6-12/h2-9,15-16,19H,10,18H2,1H3 |
| InChIKey | OTKRRNXHLHKXCL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |