C16H18N4O — CID 65186852
N-methyl-3-[5-(1-phenylpyrazol-4-yl)-1,3-oxazol-2-yl]propan-1-amine (PubChem CID 65186852) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-methyl-3-[5-(1-phenylpyrazol-4-yl)-1,3-oxazol-2-yl]propan-1-amine.
| Compound Name | N-methyl-3-[5-(1-phenylpyrazol-4-yl)-1,3-oxazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 65186852 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-methyl-3-[5-(1-phenylpyrazol-4-yl)-1,3-oxazol-2-yl]propan-1-amine |
| SMILES | CNCCCc1ncc(-c2cnn(-c3ccccc3)c2)o1 |
| InChI | InChI=1S/C16H18N4O/c1-17-9-5-8-16-18-11-15(21-16)13-10-19-20(12-13)14-6-3-2-4-7-14/h2-4,6-7,10-12,17H,5,8-9H2,1H3 |
| InChIKey | CGXJKYJOZYNLCA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|