C13H15BrN2OS — CID 65186997
N-[3-[5-(3-bromothiophen-2-yl)-1,3-oxazol-2-yl]propyl]cyclopropanamine (PubChem CID 65186997) has the molecular formula C13H15BrN2OS and a molecular weight of 327.25 g/mol. Its IUPAC name is N-[3-[5-(3-bromothiophen-2-yl)-1,3-oxazol-2-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[5-(3-bromothiophen-2-yl)-1,3-oxazol-2-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 65186997 |
| Molecular Formula | C13H15BrN2OS |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | N-[3-[5-(3-bromothiophen-2-yl)-1,3-oxazol-2-yl]propyl]cyclopropanamine |
| SMILES | Brc1ccsc1-c1cnc(CCCNC2CC2)o1 |
| InChI | InChI=1S/C13H15BrN2OS/c14-10-5-7-18-13(10)11-8-16-12(17-11)2-1-6-15-9-3-4-9/h5,7-9,15H,1-4,6H2 |
| InChIKey | KFVAXYZBJYFWED-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|