C15H16F2N2O — CID 65187135
N-[3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propyl]cyclopropanamine (PubChem CID 65187135) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is N-[3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 65187135 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propyl]cyclopropanamine |
| SMILES | Fc1cccc(F)c1-c1cnc(CCCNC2CC2)o1 |
| InChI | InChI=1S/C15H16F2N2O/c16-11-3-1-4-12(17)15(11)13-9-19-14(20-13)5-2-8-18-10-6-7-10/h1,3-4,9-10,18H,2,5-8H2 |
| InChIKey | DQNZIJSKNWINLV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|