C14H15IN2O — CID 65182015
N-[2-[5-(3-iodophenyl)-1,3-oxazol-2-yl]ethyl]cyclopropanamine (PubChem CID 65182015) has the molecular formula C14H15IN2O and a molecular weight of 354.19 g/mol. Its IUPAC name is N-[2-[5-(3-iodophenyl)-1,3-oxazol-2-yl]ethyl]cyclopropanamine.
| Compound Name | N-[2-[5-(3-iodophenyl)-1,3-oxazol-2-yl]ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 65182015 |
| Molecular Formula | C14H15IN2O |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | N-[2-[5-(3-iodophenyl)-1,3-oxazol-2-yl]ethyl]cyclopropanamine |
| SMILES | Ic1cccc(-c2cnc(CCNC3CC3)o2)c1 |
| InChI | InChI=1S/C14H15IN2O/c15-11-3-1-2-10(8-11)13-9-17-14(18-13)6-7-16-12-4-5-12/h1-3,8-9,12,16H,4-7H2 |
| InChIKey | RXSBNVCWGDVSNW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|