C11H11IN2O — CID 65178557
1-[5-(3-iodophenyl)-1,3-oxazol-2-yl]-N-methylmethanamine (PubChem CID 65178557) has the molecular formula C11H11IN2O and a molecular weight of 314.13 g/mol. Its IUPAC name is 1-[5-(3-iodophenyl)-1,3-oxazol-2-yl]-N-methylmethanamine.
| Compound Name | 1-[5-(3-iodophenyl)-1,3-oxazol-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 65178557 |
| Molecular Formula | C11H11IN2O |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 1-[5-(3-iodophenyl)-1,3-oxazol-2-yl]-N-methylmethanamine |
| SMILES | CNCc1ncc(-c2cccc(I)c2)o1 |
| InChI | InChI=1S/C11H11IN2O/c1-13-7-11-14-6-10(15-11)8-3-2-4-9(12)5-8/h2-6,13H,7H2,1H3 |
| InChIKey | DMVUIHHRXTXFSE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|