C16H22N2O2 — CID 65187014
3-[5-(2-ethoxyphenyl)-1,3-oxazol-2-yl]-N-ethylpropan-1-amine (PubChem CID 65187014) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-[5-(2-ethoxyphenyl)-1,3-oxazol-2-yl]-N-ethylpropan-1-amine.
| Compound Name | 3-[5-(2-ethoxyphenyl)-1,3-oxazol-2-yl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 65187014 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-[5-(2-ethoxyphenyl)-1,3-oxazol-2-yl]-N-ethylpropan-1-amine |
| SMILES | CCNCCCc1ncc(-c2ccccc2OCC)o1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-17-11-7-10-16-18-12-15(20-16)13-8-5-6-9-14(13)19-4-2/h5-6,8-9,12,17H,3-4,7,10-11H2,1-2H3 |
| InChIKey | UHWYFTGOTJZRHK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|