C13H13BrClNOS — CID 65187605
3-amino-2-(3-bromophenyl)-1-(5-chlorothiophen-2-yl)propan-1-ol (PubChem CID 65187605) has the molecular formula C13H13BrClNOS and a molecular weight of 346.68 g/mol. Its IUPAC name is 3-amino-2-(3-bromophenyl)-1-(5-chlorothiophen-2-yl)propan-1-ol.
| Compound Name | 3-amino-2-(3-bromophenyl)-1-(5-chlorothiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 65187605 |
| Molecular Formula | C13H13BrClNOS |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 3-amino-2-(3-bromophenyl)-1-(5-chlorothiophen-2-yl)propan-1-ol |
| SMILES | NCC(c1cccc(Br)c1)C(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H13BrClNOS/c14-9-3-1-2-8(6-9)10(7-16)13(17)11-4-5-12(15)18-11/h1-6,10,13,17H,7,16H2 |
| InChIKey | YLTFMZZERIHJKD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |