C12H20N4 — CID 65188516
1-cyclopropyl-N-(6-propylpyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 65188516) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-cyclopropyl-N-(6-propylpyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N-(6-propylpyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65188516 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 1-cyclopropyl-N-(6-propylpyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | CCCc1cc(NC(CN)C2CC2)ncn1 |
| InChI | InChI=1S/C12H20N4/c1-2-3-10-6-12(15-8-14-10)16-11(7-13)9-4-5-9/h6,8-9,11H,2-5,7,13H2,1H3,(H,14,15,16) |
| InChIKey | CVSUTCGZAUFIQN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |