C13H13F2NOS — CID 65189904
3-amino-2-(3,5-difluorophenyl)-1-thiophen-2-ylpropan-1-ol (PubChem CID 65189904) has the molecular formula C13H13F2NOS and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-amino-2-(3,5-difluorophenyl)-1-thiophen-2-ylpropan-1-ol.
| Compound Name | 3-amino-2-(3,5-difluorophenyl)-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 65189904 |
| Molecular Formula | C13H13F2NOS |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 3-amino-2-(3,5-difluorophenyl)-1-thiophen-2-ylpropan-1-ol |
| SMILES | NCC(c1cc(F)cc(F)c1)C(O)c1cccs1 |
| InChI | InChI=1S/C13H13F2NOS/c14-9-4-8(5-10(15)6-9)11(7-16)13(17)12-2-1-3-18-12/h1-6,11,13,17H,7,16H2 |
| InChIKey | BTCQWAIRGPWAFV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |