C21H19BrN4O5 — CID 6519058
(5E)-3-[(4-bromophenyl)methyl]-5-[(4-morpholin-4-yl-3-nitrophenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 6519058) has the molecular formula C21H19BrN4O5 and a molecular weight of 487.31 g/mol. Its IUPAC name is (5E)-3-[(4-bromophenyl)methyl]-5-[(4-morpholin-4-yl-3-nitrophenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-bromophenyl)methyl]-5-[(4-morpholin-4-yl-3-nitrophenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 6519058 |
| Molecular Formula | C21H19BrN4O5 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | (5E)-3-[(4-bromophenyl)methyl]-5-[(4-morpholin-4-yl-3-nitrophenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)C(=O)N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrN4O5/c22-16-4-1-14(2-5-16)13-25-20(27)17(23-21(25)28)11-15-3-6-18(19(12-15)26(29)30)24-7-9-31-10-8-24/h1-6,11-12H,7-10,13H2,(H,23,28)/b17-11+ |
| InChIKey | ADKWZSSDMBFYAH-GZTJUZNOSA-N |
| XLogP | 3.29 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|