C32H25N5O4S — CID 6519122
(2Z)-6-[(4-methoxyphenyl)methyl]-2-[[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione (PubChem CID 6519122) has the molecular formula C32H25N5O4S and a molecular weight of 575.65 g/mol. Its IUPAC name is (2Z)-6-[(4-methoxyphenyl)methyl]-2-[[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione.
| Compound Name | (2Z)-6-[(4-methoxyphenyl)methyl]-2-[[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
|---|---|
| PubChem CID | 6519122 |
| Molecular Formula | C32H25N5O4S |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | (2Z)-6-[(4-methoxyphenyl)methyl]-2-[[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
| SMILES | COc1ccc(Cc2nn3c(=O)/c(=C/c4cn(-c5ccccc5)nc4-c4ccc5c(c4)CC(C)O5)sc3nc2=O)cc1 |
| InChI | InChI=1S/C32H25N5O4S/c1-19-14-22-16-21(10-13-27(22)41-19)29-23(18-36(35-29)24-6-4-3-5-7-24)17-28-31(39)37-32(42-28)33-30(38)26(34-37)15-20-8-11-25(40-2)12-9-20/h3-13,16-19H,14-15H2,1-2H3/b28-17- |
| InChIKey | ZYSHTCGCWLMLBB-QRQIAZFYSA-N |
| XLogP | 3.83 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'} |
|---|