C9H15ClN4 — CID 65192529
2-N-(6-chloropyridazin-3-yl)pentane-1,2-diamine (PubChem CID 65192529) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is 2-N-(6-chloropyridazin-3-yl)pentane-1,2-diamine.
| Compound Name | 2-N-(6-chloropyridazin-3-yl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 65192529 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-N-(6-chloropyridazin-3-yl)pentane-1,2-diamine |
| SMILES | CCCC(CN)Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C9H15ClN4/c1-2-3-7(6-11)12-9-5-4-8(10)13-14-9/h4-5,7H,2-3,6,11H2,1H3,(H,12,14) |
| InChIKey | VTHHSJLPVRIDKW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |