C11H19N3 — CID 65192485
2-N-(6-methyl-2-pyridinyl)pentane-1,2-diamine (PubChem CID 65192485) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-N-(6-methyl-2-pyridinyl)pentane-1,2-diamine.
| Compound Name | 2-N-(6-methyl-2-pyridinyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 65192485 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-N-(6-methyl-2-pyridinyl)pentane-1,2-diamine |
| SMILES | CCCC(CN)Nc1cccc(C)n1 |
| InChI | InChI=1S/C11H19N3/c1-3-5-10(8-12)14-11-7-4-6-9(2)13-11/h4,6-7,10H,3,5,8,12H2,1-2H3,(H,13,14) |
| InChIKey | SVNUBGBXMJTFQX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |