C11H18N2O2 — CID 106157813
4-methoxy-3-[(6-methyl-2-pyridinyl)amino]butan-1-ol (PubChem CID 106157813) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-methoxy-3-[(6-methyl-2-pyridinyl)amino]butan-1-ol.
| Compound Name | 4-methoxy-3-[(6-methyl-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106157813 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-methoxy-3-[(6-methyl-2-pyridinyl)amino]butan-1-ol |
| SMILES | COCC(CCO)Nc1cccc(C)n1 |
| InChI | InChI=1S/C11H18N2O2/c1-9-4-3-5-11(12-9)13-10(6-7-14)8-15-2/h3-5,10,14H,6-8H2,1-2H3,(H,12,13) |
| InChIKey | PZDZWTRKYLEOFJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |