C11H19N3O — CID 80836609
6-N-(1-methoxybutan-2-yl)-2-N-methylpyridine-2,6-diamine (PubChem CID 80836609) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 6-N-(1-methoxybutan-2-yl)-2-N-methylpyridine-2,6-diamine.
| Compound Name | 6-N-(1-methoxybutan-2-yl)-2-N-methylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80836609 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 6-N-(1-methoxybutan-2-yl)-2-N-methylpyridine-2,6-diamine |
| SMILES | CCC(COC)Nc1cccc(NC)n1 |
| InChI | InChI=1S/C11H19N3O/c1-4-9(8-15-3)13-11-7-5-6-10(12-2)14-11/h5-7,9H,4,8H2,1-3H3,(H2,12,13,14) |
| InChIKey | QQCMAUYFSUAQAR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |